C4HCl5F4 — CID 87308636
2,3,3,4,4-pentachloro-1,1,1,2-tetrafluorobutane (PubChem CID 87308636) has the molecular formula C4HCl5F4 and a molecular weight of 302.31 g/mol. Its IUPAC name is 2,3,3,4,4-pentachloro-1,1,1,2-tetrafluorobutane.
| Compound Name | 2,3,3,4,4-pentachloro-1,1,1,2-tetrafluorobutane |
|---|---|
| PubChem CID | 87308636 |
| Molecular Formula | C4HCl5F4 |
| Molecular Weight | 302.31 g/mol |
| Exact Mass | 299.85 |
| IUPAC Name | 2,3,3,4,4-pentachloro-1,1,1,2-tetrafluorobutane |
| SMILES | FC(F)(F)C(F)(Cl)C(Cl)(Cl)C(Cl)Cl |
| InChI | InChI=1S/C4HCl5F4/c5-1(6)2(7,8)3(9,10)4(11,12)13/h1H |
| InChIKey | AOQWQCDXNRGLPE-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.31 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|