C4H2Cl3F5 — CID 18915995
2,2,3-trichloro-1,1,1,4,4-pentafluorobutane (PubChem CID 18915995) has the molecular formula C4H2Cl3F5 and a molecular weight of 251.41 g/mol. Its IUPAC name is 2,2,3-trichloro-1,1,1,4,4-pentafluorobutane.
| Compound Name | 2,2,3-trichloro-1,1,1,4,4-pentafluorobutane |
|---|---|
| PubChem CID | 18915995 |
| Molecular Formula | C4H2Cl3F5 |
| Molecular Weight | 251.41 g/mol |
| Exact Mass | 249.91 |
| IUPAC Name | 2,2,3-trichloro-1,1,1,4,4-pentafluorobutane |
| SMILES | FC(F)C(Cl)C(Cl)(Cl)C(F)(F)F |
| InChI | InChI=1S/C4H2Cl3F5/c5-1(2(8)9)3(6,7)4(10,11)12/h1-2H |
| InChIKey | PTCRZTQWSWNANM-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.41 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|