C6H2Cl2F10 — CID 18916016
3,4-dichloro-1,1,1,2,2,3,4,5,6,6-decafluorohexane (PubChem CID 18916016) has the molecular formula C6H2Cl2F10 and a molecular weight of 334.97 g/mol. Its IUPAC name is 3,4-dichloro-1,1,1,2,2,3,4,5,6,6-decafluorohexane.
| Compound Name | 3,4-dichloro-1,1,1,2,2,3,4,5,6,6-decafluorohexane |
|---|---|
| PubChem CID | 18916016 |
| Molecular Formula | C6H2Cl2F10 |
| Molecular Weight | 334.97 g/mol |
| Exact Mass | 333.94 |
| IUPAC Name | 3,4-dichloro-1,1,1,2,2,3,4,5,6,6-decafluorohexane |
| SMILES | FC(F)C(F)C(F)(Cl)C(F)(Cl)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C6H2Cl2F10/c7-3(12,1(9)2(10)11)4(8,13)5(14,15)6(16,17)18/h1-2H |
| InChIKey | BSJMDZGGCXVAHK-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.97 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|