C3H4ClF5 — CID 161180973
chloro(trifluoro)methane;1,1-difluoroethane (PubChem CID 161180973) has the molecular formula C3H4ClF5 and a molecular weight of 170.51 g/mol. Its IUPAC name is chloro(trifluoro)methane;1,1-difluoroethane.
| Compound Name | chloro(trifluoro)methane;1,1-difluoroethane |
|---|---|
| PubChem CID | 161180973 |
| Molecular Formula | C3H4ClF5 |
| Molecular Weight | 170.51 g/mol |
| Exact Mass | 169.99 |
| IUPAC Name | chloro(trifluoro)methane;1,1-difluoroethane |
| SMILES | CC(F)F.FC(F)(F)Cl |
| InChI | InChI=1S/C2H4F2.CClF3/c1-2(3)4;2-1(3,4)5/h2H,1H3; |
| InChIKey | USLIAXBGMLWTGM-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.51 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|