About 1,1-difluoroethane
1,1-difluoroethane (PubChem CID 6368) has the molecular formula C2H4F2
and a molecular weight of 66.05 g/mol. Its IUPAC name is 1,1-difluoroethane.
Molecular Properties
| Compound Name | 1,1-difluoroethane |
| PubChem CID | 6368 |
| Molecular Formula | C2H4F2 |
| Molecular Weight | 66.05 g/mol |
| Exact Mass | 66.03 |
| IUPAC Name | 1,1-difluoroethane |
| SMILES | CC(F)F |
| InChI | InChI=1S/C2H4F2/c1-2(3)4/h2H,1H3 |
| InChIKey | NPNPZTNLOVBDOC-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 4 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 66.05 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1,1-difluoroethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-difluoroethane?
The IUPAC name of 1,1-difluoroethane (CID 6368) is 1,1-difluoroethane.
What is the SMILES notation for 1,1-difluoroethane?
The canonical SMILES for 1,1-difluoroethane is CC(F)F.
What is the InChIKey of 1,1-difluoroethane?
The InChIKey is NPNPZTNLOVBDOC-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H4F2/c1-2(3)4/h2H,1H3.
What are the key properties of 1,1-difluoroethane?
1,1-difluoroethane has a molecular weight of 66.05 g/mol, XLogP of 1.27, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-difluoroethane is sourced from PubChem (CID 6368), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).