About chloro(difluoro)methane;dichloro(difluoro)methane;trichloro(fluoro)methane
chloro(difluoro)methane;dichloro(difluoro)methane;trichloro(fluoro)methane (PubChem CID 19892956) has the molecular formula C3HCl6F5
and a molecular weight of 344.75 g/mol. Its IUPAC name is chloro(difluoro)methane;dichloro(difluoro)methane;trichloro(fluoro)methane.
Molecular Properties
| Compound Name | chloro(difluoro)methane;dichloro(difluoro)methane;trichloro(fluoro)methane |
| PubChem CID | 19892956 |
| Molecular Formula | C3HCl6F5 |
| Molecular Weight | 344.75 g/mol |
| Exact Mass | 341.81 |
| IUPAC Name | chloro(difluoro)methane;dichloro(difluoro)methane;trichloro(fluoro)methane |
| SMILES | FC(Cl)(Cl)Cl.FC(F)(Cl)Cl.FC(F)Cl |
| InChI | InChI=1S/CCl3F.CCl2F2.CHClF2/c2*2-1(3,4)5;2-1(3)4/h;;1H |
| InChIKey | REEWMTJLDPNYMG-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 344.75 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze chloro(difluoro)methane;dichloro(difluoro)methane;trichloro(fluoro)methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chloro(difluoro)methane;dichloro(difluoro)methane;trichloro(fluoro)methane?
The IUPAC name of chloro(difluoro)methane;dichloro(difluoro)methane;trichloro(fluoro)methane (CID 19892956) is chloro(difluoro)methane;dichloro(difluoro)methane;trichloro(fluoro)methane.
What is the SMILES notation for chloro(difluoro)methane;dichloro(difluoro)methane;trichloro(fluoro)methane?
The canonical SMILES for chloro(difluoro)methane;dichloro(difluoro)methane;trichloro(fluoro)methane is FC(Cl)(Cl)Cl.FC(F)(Cl)Cl.FC(F)Cl.
What is the InChIKey of chloro(difluoro)methane;dichloro(difluoro)methane;trichloro(fluoro)methane?
The InChIKey is REEWMTJLDPNYMG-UHFFFAOYSA-N. The full InChI is InChI=1S/CCl3F.CCl2F2.CHClF2/c2*2-1(3,4)5;2-1(3)4/h;;1H.
What are the key properties of chloro(difluoro)methane;dichloro(difluoro)methane;trichloro(fluoro)methane?
chloro(difluoro)methane;dichloro(difluoro)methane;trichloro(fluoro)methane has a molecular weight of 344.75 g/mol, XLogP of 5.75, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for chloro(difluoro)methane;dichloro(difluoro)methane;trichloro(fluoro)methane is sourced from PubChem (CID 19892956), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).