About dichloro(difluoro)methane;methane;trichloro(fluoro)methane
dichloro(difluoro)methane;methane;trichloro(fluoro)methane (PubChem CID 157345787) has the molecular formula C3H4Cl5F3
and a molecular weight of 274.32 g/mol. Its IUPAC name is dichloro(difluoro)methane;methane;trichloro(fluoro)methane.
Molecular Properties
| Compound Name | dichloro(difluoro)methane;methane;trichloro(fluoro)methane |
| PubChem CID | 157345787 |
| Molecular Formula | C3H4Cl5F3 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 271.87 |
| IUPAC Name | dichloro(difluoro)methane;methane;trichloro(fluoro)methane |
| SMILES | C.FC(Cl)(Cl)Cl.FC(F)(Cl)Cl |
| InChI | InChI=1S/CCl3F.CCl2F2.CH4/c2*2-1(3,4)5;/h;;1H4 |
| InChIKey | BGYISJPVQJQDAM-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze dichloro(difluoro)methane;methane;trichloro(fluoro)methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichloro(difluoro)methane;methane;trichloro(fluoro)methane?
The IUPAC name of dichloro(difluoro)methane;methane;trichloro(fluoro)methane (CID 157345787) is dichloro(difluoro)methane;methane;trichloro(fluoro)methane.
What is the SMILES notation for dichloro(difluoro)methane;methane;trichloro(fluoro)methane?
The canonical SMILES for dichloro(difluoro)methane;methane;trichloro(fluoro)methane is C.FC(Cl)(Cl)Cl.FC(F)(Cl)Cl.
What is the InChIKey of dichloro(difluoro)methane;methane;trichloro(fluoro)methane?
The InChIKey is BGYISJPVQJQDAM-UHFFFAOYSA-N. The full InChI is InChI=1S/CCl3F.CCl2F2.CH4/c2*2-1(3,4)5;/h;;1H4.
What are the key properties of dichloro(difluoro)methane;methane;trichloro(fluoro)methane?
dichloro(difluoro)methane;methane;trichloro(fluoro)methane has a molecular weight of 274.32 g/mol, XLogP of 4.93, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for dichloro(difluoro)methane;methane;trichloro(fluoro)methane is sourced from PubChem (CID 157345787), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).