About 1-chloro-1,1-difluoropropane;trichloro(fluoro)methane
1-chloro-1,1-difluoropropane;trichloro(fluoro)methane (PubChem CID 135365106) has the molecular formula C4H5Cl4F3
and a molecular weight of 251.89 g/mol. Its IUPAC name is 1-chloro-1,1-difluoropropane;trichloro(fluoro)methane.
Molecular Properties
| Compound Name | 1-chloro-1,1-difluoropropane;trichloro(fluoro)methane |
| PubChem CID | 135365106 |
| Molecular Formula | C4H5Cl4F3 |
| Molecular Weight | 251.89 g/mol |
| Exact Mass | 249.91 |
| IUPAC Name | 1-chloro-1,1-difluoropropane;trichloro(fluoro)methane |
| SMILES | CCC(F)(F)Cl.FC(Cl)(Cl)Cl |
| InChI | InChI=1S/C3H5ClF2.CCl3F/c1-2-3(4,5)6;2-1(3,4)5/h2H2,1H3; |
| InChIKey | IHVQTMNYJBVHJS-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.89 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-chloro-1,1-difluoropropane;trichloro(fluoro)methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-1,1-difluoropropane;trichloro(fluoro)methane?
The IUPAC name of 1-chloro-1,1-difluoropropane;trichloro(fluoro)methane (CID 135365106) is 1-chloro-1,1-difluoropropane;trichloro(fluoro)methane.
What is the SMILES notation for 1-chloro-1,1-difluoropropane;trichloro(fluoro)methane?
The canonical SMILES for 1-chloro-1,1-difluoropropane;trichloro(fluoro)methane is CCC(F)(F)Cl.FC(Cl)(Cl)Cl.
What is the InChIKey of 1-chloro-1,1-difluoropropane;trichloro(fluoro)methane?
The InChIKey is IHVQTMNYJBVHJS-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H5ClF2.CCl3F/c1-2-3(4,5)6;2-1(3,4)5/h2H2,1H3;.
What are the key properties of 1-chloro-1,1-difluoropropane;trichloro(fluoro)methane?
1-chloro-1,1-difluoropropane;trichloro(fluoro)methane has a molecular weight of 251.89 g/mol, XLogP of 4.51, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-1,1-difluoropropane;trichloro(fluoro)methane is sourced from PubChem (CID 135365106), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).