C3Cl4F6 — CID 87764597
dichloro(difluoro)methane;1,1-dichloro-1,2,2,2-tetrafluoroethane (PubChem CID 87764597) has the molecular formula C3Cl4F6 and a molecular weight of 291.83 g/mol. Its IUPAC name is dichloro(difluoro)methane;1,1-dichloro-1,2,2,2-tetrafluoroethane.
| Compound Name | dichloro(difluoro)methane;1,1-dichloro-1,2,2,2-tetrafluoroethane |
|---|---|
| PubChem CID | 87764597 |
| Molecular Formula | C3Cl4F6 |
| Molecular Weight | 291.83 g/mol |
| Exact Mass | 289.87 |
| IUPAC Name | dichloro(difluoro)methane;1,1-dichloro-1,2,2,2-tetrafluoroethane |
| SMILES | FC(F)(Cl)Cl.FC(F)(F)C(F)(Cl)Cl |
| InChI | InChI=1S/C2Cl2F4.CCl2F2/c3-1(4,5)2(6,7)8;2-1(3,4)5 |
| InChIKey | LMMBGFRHSXBSQC-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.83 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|