C6Cl2F12 — CID 154106532
2,3-dichloro-1,1,1,4,4,4-hexafluoro-2,3-bis(trifluoromethyl)butane (PubChem CID 154106532) has the molecular formula C6Cl2F12 and a molecular weight of 370.95 g/mol. Its IUPAC name is 2,3-dichloro-1,1,1,4,4,4-hexafluoro-2,3-bis(trifluoromethyl)butane.
| Compound Name | 2,3-dichloro-1,1,1,4,4,4-hexafluoro-2,3-bis(trifluoromethyl)butane |
|---|---|
| PubChem CID | 154106532 |
| Molecular Formula | C6Cl2F12 |
| Molecular Weight | 370.95 g/mol |
| Exact Mass | 369.92 |
| IUPAC Name | 2,3-dichloro-1,1,1,4,4,4-hexafluoro-2,3-bis(trifluoromethyl)butane |
| SMILES | FC(F)(F)C(Cl)(C(F)(F)F)C(Cl)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C6Cl2F12/c7-1(3(9,10)11,4(12,13)14)2(8,5(15,16)17)6(18,19)20 |
| InChIKey | QMDJWKDLPTUHFL-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.95 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|