About chloro(difluoro)methane
chloro(difluoro)methane (PubChem CID 102425690) has the molecular formula CHClF2
and a molecular weight of 85.98 g/mol. Its IUPAC name is chloro(difluoro)methane.
Molecular Properties
| Compound Name | chloro(difluoro)methane |
| PubChem CID | 102425690 |
| Molecular Formula | CHClF2 |
| Molecular Weight | 85.98 g/mol |
| Exact Mass | 85.97 |
| IUPAC Name | chloro(difluoro)methane |
| SMILES | FC(F)[35Cl] |
| InChI | InChI=1S/CHClF2/c2-1(3)4/h1H/i2+0 |
| InChIKey | VOPWNXZWBYDODV-ULIRUUBJSA-N |
| XLogP | 1.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 4 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 85.98 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze chloro(difluoro)methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chloro(difluoro)methane?
The IUPAC name of chloro(difluoro)methane (CID 102425690) is chloro(difluoro)methane.
What is the SMILES notation for chloro(difluoro)methane?
The canonical SMILES for chloro(difluoro)methane is FC(F)[35Cl].
What is the InChIKey of chloro(difluoro)methane?
The InChIKey is VOPWNXZWBYDODV-ULIRUUBJSA-N. The full InChI is InChI=1S/CHClF2/c2-1(3)4/h1H/i2+0.
What are the key properties of chloro(difluoro)methane?
chloro(difluoro)methane has a molecular weight of 85.98 g/mol, XLogP of 1.45, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for chloro(difluoro)methane is sourced from PubChem (CID 102425690), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).