About trichloro(113C)methane
trichloro(113C)methane (PubChem CID 10176135) has the molecular formula CHCl3
and a molecular weight of 120.37 g/mol. Its IUPAC name is trichloro(113C)methane.
Molecular Properties
| Compound Name | trichloro(113C)methane |
| PubChem CID | 10176135 |
| Molecular Formula | CHCl3 |
| Molecular Weight | 120.37 g/mol |
| Exact Mass | 118.92 |
| IUPAC Name | trichloro(113C)methane |
| SMILES | Cl[13CH](Cl)Cl |
| InChI | InChI=1S/CHCl3/c2-1(3)4/h1H/i1+1 |
| InChIKey | HEDRZPFGACZZDS-OUBTZVSYSA-N |
| XLogP | 1.99 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 4 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 120.37 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze trichloro(113C)methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trichloro(113C)methane?
The IUPAC name of trichloro(113C)methane (CID 10176135) is trichloro(113C)methane.
What is the SMILES notation for trichloro(113C)methane?
The canonical SMILES for trichloro(113C)methane is Cl[13CH](Cl)Cl.
What is the InChIKey of trichloro(113C)methane?
The InChIKey is HEDRZPFGACZZDS-OUBTZVSYSA-N. The full InChI is InChI=1S/CHCl3/c2-1(3)4/h1H/i1+1.
What are the key properties of trichloro(113C)methane?
trichloro(113C)methane has a molecular weight of 120.37 g/mol, XLogP of 1.99, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for trichloro(113C)methane is sourced from PubChem (CID 10176135), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).