About chloroform;tetrachlorogermane
chloroform;tetrachlorogermane (PubChem CID 175314547) has the molecular formula CHCl7Ge
and a molecular weight of 333.80 g/mol. Its IUPAC name is chloroform;tetrachlorogermane.
Molecular Properties
| Compound Name | chloroform;tetrachlorogermane |
| PubChem CID | 175314547 |
| Molecular Formula | CHCl7Ge |
| Molecular Weight | 333.80 g/mol |
| Exact Mass | 331.71 |
| IUPAC Name | chloroform;tetrachlorogermane |
| SMILES | ClC(Cl)Cl.Cl[Ge](Cl)(Cl)Cl |
| InChI | InChI=1S/CHCl3.Cl4Ge/c2-1(3)4;1-5(2,3)4/h1H; |
| InChIKey | VFKZDJGGPPOJNI-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.80 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze chloroform;tetrachlorogermane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chloroform;tetrachlorogermane?
The IUPAC name of chloroform;tetrachlorogermane (CID 175314547) is chloroform;tetrachlorogermane.
What is the SMILES notation for chloroform;tetrachlorogermane?
The canonical SMILES for chloroform;tetrachlorogermane is ClC(Cl)Cl.Cl[Ge](Cl)(Cl)Cl.
What is the InChIKey of chloroform;tetrachlorogermane?
The InChIKey is VFKZDJGGPPOJNI-UHFFFAOYSA-N. The full InChI is InChI=1S/CHCl3.Cl4Ge/c2-1(3)4;1-5(2,3)4/h1H;.
What are the key properties of chloroform;tetrachlorogermane?
chloroform;tetrachlorogermane has a molecular weight of 333.80 g/mol, XLogP of 4.36, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for chloroform;tetrachlorogermane is sourced from PubChem (CID 175314547), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).