About chlorocopper;chloroform
chlorocopper;chloroform (PubChem CID 175032666) has the molecular formula CHCl4Cu
and a molecular weight of 218.38 g/mol. Its IUPAC name is chlorocopper;chloroform.
Molecular Properties
| Compound Name | chlorocopper;chloroform |
| PubChem CID | 175032666 |
| Molecular Formula | CHCl4Cu |
| Molecular Weight | 218.38 g/mol |
| Exact Mass | 215.81 |
| IUPAC Name | chlorocopper;chloroform |
| SMILES | ClC(Cl)Cl.Cl[Cu] |
| InChI | InChI=1S/CHCl3.ClH.Cu/c2-1(3)4;;/h1H;1H;/q;;+1/p-1 |
| InChIKey | JTWGUEDRIBRTGQ-UHFFFAOYSA-M |
| XLogP | 2.67 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.38 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze chlorocopper;chloroform with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chlorocopper;chloroform?
The IUPAC name of chlorocopper;chloroform (CID 175032666) is chlorocopper;chloroform.
What is the SMILES notation for chlorocopper;chloroform?
The canonical SMILES for chlorocopper;chloroform is ClC(Cl)Cl.Cl[Cu].
What is the InChIKey of chlorocopper;chloroform?
The InChIKey is JTWGUEDRIBRTGQ-UHFFFAOYSA-M. The full InChI is InChI=1S/CHCl3.ClH.Cu/c2-1(3)4;;/h1H;1H;/q;;+1/p-1.
What are the key properties of chlorocopper;chloroform?
chlorocopper;chloroform has a molecular weight of 218.38 g/mol, XLogP of 2.67, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for chlorocopper;chloroform is sourced from PubChem (CID 175032666), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).