About sodium;chloroform;hypochlorite
sodium;chloroform;hypochlorite (PubChem CID 87141272) has the molecular formula CHCl4NaO
and a molecular weight of 193.82 g/mol. Its IUPAC name is sodium;chloroform;hypochlorite.
Molecular Properties
| Compound Name | sodium;chloroform;hypochlorite |
| PubChem CID | 87141272 |
| Molecular Formula | CHCl4NaO |
| Molecular Weight | 193.82 g/mol |
| Exact Mass | 191.87 |
| IUPAC Name | sodium;chloroform;hypochlorite |
| SMILES | ClC(Cl)Cl.[Na+].[O-]Cl |
| InChI | InChI=1S/CHCl3.ClO.Na/c2-1(3)4;1-2;/h1H;;/q;-1;+1 |
| InChIKey | BHDWNGYXLQBZKS-UHFFFAOYSA-N |
| XLogP | -1.51 |
| TPSA | 23.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.82 |
| LogP ≤ 5 | -1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze sodium;chloroform;hypochlorite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;chloroform;hypochlorite?
The IUPAC name of sodium;chloroform;hypochlorite (CID 87141272) is sodium;chloroform;hypochlorite.
What is the SMILES notation for sodium;chloroform;hypochlorite?
The canonical SMILES for sodium;chloroform;hypochlorite is ClC(Cl)Cl.[Na+].[O-]Cl.
What is the InChIKey of sodium;chloroform;hypochlorite?
The InChIKey is BHDWNGYXLQBZKS-UHFFFAOYSA-N. The full InChI is InChI=1S/CHCl3.ClO.Na/c2-1(3)4;1-2;/h1H;;/q;-1;+1.
What are the key properties of sodium;chloroform;hypochlorite?
sodium;chloroform;hypochlorite has a molecular weight of 193.82 g/mol, XLogP of -1.51, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;chloroform;hypochlorite is sourced from PubChem (CID 87141272), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).