chloroform chloride

CHCl4- — CID 18671957

IUPACchloroform chloride
SMILESClC(Cl)Cl.[Cl-]
InChIInChI=1S/CHCl3.ClH/c2-1(3)4;/h1H;1H/p-1
InChIKeyDRWMGJONTCWKES-UHFFFAOYSA-M
MW154.83 g/mol
LogP-1.01
Rot. Bonds

About chloroform chloride

chloroform chloride (PubChem CID 18671957) has the molecular formula CHCl4- and a molecular weight of 154.83 g/mol. Its IUPAC name is chloroform chloride.

Molecular Properties

Compound Namechloroform chloride
PubChem CID18671957
Molecular FormulaCHCl4-
Molecular Weight154.83 g/mol
Exact Mass152.88
IUPAC Namechloroform chloride
SMILESClC(Cl)Cl.[Cl-]
InChIInChI=1S/CHCl3.ClH/c2-1(3)4;/h1H;1H/p-1
InChIKeyDRWMGJONTCWKES-UHFFFAOYSA-M
XLogP-1.01
TPSA0.00 Ų
H-Bond Donors
H-Bond Acceptors
Rotatable Bonds
Heavy Atoms5
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500154.83
LogP ≤ 5-1.01
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 100

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'alkyl_halide', 'substructure': 'N/A'}

Analyze chloroform chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of chloroform chloride?
The IUPAC name of chloroform chloride (CID 18671957) is chloroform chloride.
What is the SMILES notation for chloroform chloride?
The canonical SMILES for chloroform chloride is ClC(Cl)Cl.[Cl-].
What is the InChIKey of chloroform chloride?
The InChIKey is DRWMGJONTCWKES-UHFFFAOYSA-M. The full InChI is InChI=1S/CHCl3.ClH/c2-1(3)4;/h1H;1H/p-1.
What are the key properties of chloroform chloride?
chloroform chloride has a molecular weight of 154.83 g/mol, XLogP of -1.01, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for chloroform chloride is sourced from PubChem (CID 18671957), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).