About chloroform chloride
chloroform chloride (PubChem CID 18671957) has the molecular formula CHCl4-
and a molecular weight of 154.83 g/mol. Its IUPAC name is chloroform chloride.
Molecular Properties
| Compound Name | chloroform chloride |
| PubChem CID | 18671957 |
| Molecular Formula | CHCl4- |
| Molecular Weight | 154.83 g/mol |
| Exact Mass | 152.88 |
| IUPAC Name | chloroform chloride |
| SMILES | ClC(Cl)Cl.[Cl-] |
| InChI | InChI=1S/CHCl3.ClH/c2-1(3)4;/h1H;1H/p-1 |
| InChIKey | DRWMGJONTCWKES-UHFFFAOYSA-M |
| XLogP | -1.01 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.83 |
| LogP ≤ 5 | -1.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze chloroform chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chloroform chloride?
The IUPAC name of chloroform chloride (CID 18671957) is chloroform chloride.
What is the SMILES notation for chloroform chloride?
The canonical SMILES for chloroform chloride is ClC(Cl)Cl.[Cl-].
What is the InChIKey of chloroform chloride?
The InChIKey is DRWMGJONTCWKES-UHFFFAOYSA-M. The full InChI is InChI=1S/CHCl3.ClH/c2-1(3)4;/h1H;1H/p-1.
What are the key properties of chloroform chloride?
chloroform chloride has a molecular weight of 154.83 g/mol, XLogP of -1.01, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for chloroform chloride is sourced from PubChem (CID 18671957), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).