About chloroform;dichlorozinc
chloroform;dichlorozinc (PubChem CID 174541287) has the molecular formula CHCl5Zn
and a molecular weight of 255.67 g/mol. Its IUPAC name is chloroform;dichlorozinc.
Molecular Properties
| Compound Name | chloroform;dichlorozinc |
| PubChem CID | 174541287 |
| Molecular Formula | CHCl5Zn |
| Molecular Weight | 255.67 g/mol |
| Exact Mass | 251.78 |
| IUPAC Name | chloroform;dichlorozinc |
| SMILES | ClC(Cl)Cl.Cl[Zn]Cl |
| InChI | InChI=1S/CHCl3.2ClH.Zn/c2-1(3)4;;;/h1H;2*1H;/q;;;+2/p-2 |
| InChIKey | FDAMLIPCJAJQOJ-UHFFFAOYSA-L |
| XLogP | 3.36 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.67 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze chloroform;dichlorozinc with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chloroform;dichlorozinc?
The IUPAC name of chloroform;dichlorozinc (CID 174541287) is chloroform;dichlorozinc.
What is the SMILES notation for chloroform;dichlorozinc?
The canonical SMILES for chloroform;dichlorozinc is ClC(Cl)Cl.Cl[Zn]Cl.
What is the InChIKey of chloroform;dichlorozinc?
The InChIKey is FDAMLIPCJAJQOJ-UHFFFAOYSA-L. The full InChI is InChI=1S/CHCl3.2ClH.Zn/c2-1(3)4;;;/h1H;2*1H;/q;;;+2/p-2.
What are the key properties of chloroform;dichlorozinc?
chloroform;dichlorozinc has a molecular weight of 255.67 g/mol, XLogP of 3.36, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for chloroform;dichlorozinc is sourced from PubChem (CID 174541287), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).