About magnesium;2-chloropropane;dichloride
magnesium;2-chloropropane;dichloride (PubChem CID 158508799) has the molecular formula C3H7Cl3Mg
and a molecular weight of 173.75 g/mol. Its IUPAC name is magnesium;2-chloropropane;dichloride.
Molecular Properties
| Compound Name | magnesium;2-chloropropane;dichloride |
| PubChem CID | 158508799 |
| Molecular Formula | C3H7Cl3Mg |
| Molecular Weight | 173.75 g/mol |
| Exact Mass | 171.95 |
| IUPAC Name | magnesium;2-chloropropane;dichloride |
| SMILES | CC(C)Cl.[Cl-].[Cl-].[Mg+2] |
| InChI | InChI=1S/C3H7Cl.2ClH.Mg/c1-3(2)4;;;/h3H,1-2H3;2*1H;/q;;;+2/p-2 |
| InChIKey | HKUFSVWZBPBDOH-UHFFFAOYSA-L |
| XLogP | -4.74 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.75 |
| LogP ≤ 5 | -4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze magnesium;2-chloropropane;dichloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of magnesium;2-chloropropane;dichloride?
The IUPAC name of magnesium;2-chloropropane;dichloride (CID 158508799) is magnesium;2-chloropropane;dichloride.
What is the SMILES notation for magnesium;2-chloropropane;dichloride?
The canonical SMILES for magnesium;2-chloropropane;dichloride is CC(C)Cl.[Cl-].[Cl-].[Mg+2].
What is the InChIKey of magnesium;2-chloropropane;dichloride?
The InChIKey is HKUFSVWZBPBDOH-UHFFFAOYSA-L. The full InChI is InChI=1S/C3H7Cl.2ClH.Mg/c1-3(2)4;;;/h3H,1-2H3;2*1H;/q;;;+2/p-2.
What are the key properties of magnesium;2-chloropropane;dichloride?
magnesium;2-chloropropane;dichloride has a molecular weight of 173.75 g/mol, XLogP of -4.74, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for magnesium;2-chloropropane;dichloride is sourced from PubChem (CID 158508799), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).