About 2-chloropropane;bis(N-methylmethanamine)
2-chloropropane;bis(N-methylmethanamine) (PubChem CID 88525662) has the molecular formula C7H21ClN2
and a molecular weight of 168.71 g/mol. Its IUPAC name is 2-chloropropane;bis(N-methylmethanamine).
Molecular Properties
| Compound Name | 2-chloropropane;bis(N-methylmethanamine) |
| PubChem CID | 88525662 |
| Molecular Formula | C7H21ClN2 |
| Molecular Weight | 168.71 g/mol |
| Exact Mass | 168.14 |
| IUPAC Name | 2-chloropropane;bis(N-methylmethanamine) |
| SMILES | CC(C)Cl.CNC.CNC |
| InChI | InChI=1S/C3H7Cl.2C2H7N/c1-3(2)4;2*1-3-2/h3H,1-2H3;2*3H,1-2H3 |
| InChIKey | OKUBZWWHFSOYMU-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.71 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-chloropropane;bis(N-methylmethanamine) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloropropane;bis(N-methylmethanamine)?
The IUPAC name of 2-chloropropane;bis(N-methylmethanamine) (CID 88525662) is 2-chloropropane;bis(N-methylmethanamine).
What is the SMILES notation for 2-chloropropane;bis(N-methylmethanamine)?
The canonical SMILES for 2-chloropropane;bis(N-methylmethanamine) is CC(C)Cl.CNC.CNC.
What is the InChIKey of 2-chloropropane;bis(N-methylmethanamine)?
The InChIKey is OKUBZWWHFSOYMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H7Cl.2C2H7N/c1-3(2)4;2*1-3-2/h3H,1-2H3;2*3H,1-2H3.
What are the key properties of 2-chloropropane;bis(N-methylmethanamine)?
2-chloropropane;bis(N-methylmethanamine) has a molecular weight of 168.71 g/mol, XLogP of 1.30, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloropropane;bis(N-methylmethanamine) is sourced from PubChem (CID 88525662), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).