About 1-chloro-2-methylpropane;N-methylmethanamine
1-chloro-2-methylpropane;N-methylmethanamine (PubChem CID 175109198) has the molecular formula C6H16ClN
and a molecular weight of 137.65 g/mol. Its IUPAC name is 1-chloro-2-methylpropane;N-methylmethanamine.
Molecular Properties
| Compound Name | 1-chloro-2-methylpropane;N-methylmethanamine |
| PubChem CID | 175109198 |
| Molecular Formula | C6H16ClN |
| Molecular Weight | 137.65 g/mol |
| Exact Mass | 137.10 |
| IUPAC Name | 1-chloro-2-methylpropane;N-methylmethanamine |
| SMILES | CC(C)CCl.CNC |
| InChI | InChI=1S/C4H9Cl.C2H7N/c1-4(2)3-5;1-3-2/h4H,3H2,1-2H3;3H,1-2H3 |
| InChIKey | BEGGEEMXYRFACP-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 137.65 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-chloro-2-methylpropane;N-methylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-2-methylpropane;N-methylmethanamine?
The IUPAC name of 1-chloro-2-methylpropane;N-methylmethanamine (CID 175109198) is 1-chloro-2-methylpropane;N-methylmethanamine.
What is the SMILES notation for 1-chloro-2-methylpropane;N-methylmethanamine?
The canonical SMILES for 1-chloro-2-methylpropane;N-methylmethanamine is CC(C)CCl.CNC.
What is the InChIKey of 1-chloro-2-methylpropane;N-methylmethanamine?
The InChIKey is BEGGEEMXYRFACP-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9Cl.C2H7N/c1-4(2)3-5;1-3-2/h4H,3H2,1-2H3;3H,1-2H3.
What are the key properties of 1-chloro-2-methylpropane;N-methylmethanamine?
1-chloro-2-methylpropane;N-methylmethanamine has a molecular weight of 137.65 g/mol, XLogP of 1.72, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-2-methylpropane;N-methylmethanamine is sourced from PubChem (CID 175109198), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).