C8H18ClN — CID 116952715
1-chloro-N,5-dimethylhexan-3-amine (PubChem CID 116952715) has the molecular formula C8H18ClN and a molecular weight of 163.69 g/mol. Its IUPAC name is 1-chloro-N,5-dimethylhexan-3-amine.
| Compound Name | 1-chloro-N,5-dimethylhexan-3-amine |
|---|---|
| PubChem CID | 116952715 |
| Molecular Formula | C8H18ClN |
| Molecular Weight | 163.69 g/mol |
| Exact Mass | 163.11 |
| IUPAC Name | 1-chloro-N,5-dimethylhexan-3-amine |
| SMILES | CNC(CCCl)CC(C)C |
| InChI | InChI=1S/C8H18ClN/c1-7(2)6-8(10-3)4-5-9/h7-8,10H,4-6H2,1-3H3 |
| InChIKey | MQPSQXUYFYAGET-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.69 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|