C7H16FN — CID 112708643
1-fluoro-N,4-dimethylpentan-2-amine (PubChem CID 112708643) has the molecular formula C7H16FN and a molecular weight of 133.21 g/mol. Its IUPAC name is 1-fluoro-N,4-dimethylpentan-2-amine.
| Compound Name | 1-fluoro-N,4-dimethylpentan-2-amine |
|---|---|
| PubChem CID | 112708643 |
| Molecular Formula | C7H16FN |
| Molecular Weight | 133.21 g/mol |
| Exact Mass | 133.13 |
| IUPAC Name | 1-fluoro-N,4-dimethylpentan-2-amine |
| SMILES | CNC(CF)CC(C)C |
| InChI | InChI=1S/C7H16FN/c1-6(2)4-7(5-8)9-3/h6-7,9H,4-5H2,1-3H3 |
| InChIKey | JJDQKRBNSZNGSF-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 133.21 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |