C9H21NO — CID 61412453
1-methoxy-N,5-dimethylhexan-3-amine (PubChem CID 61412453) has the molecular formula C9H21NO and a molecular weight of 159.27 g/mol. Its IUPAC name is 1-methoxy-N,5-dimethylhexan-3-amine.
| Compound Name | 1-methoxy-N,5-dimethylhexan-3-amine |
|---|---|
| PubChem CID | 61412453 |
| Molecular Formula | C9H21NO |
| Molecular Weight | 159.27 g/mol |
| Exact Mass | 159.16 |
| IUPAC Name | 1-methoxy-N,5-dimethylhexan-3-amine |
| SMILES | CNC(CCOC)CC(C)C |
| InChI | InChI=1S/C9H21NO/c1-8(2)7-9(10-3)5-6-11-4/h8-10H,5-7H2,1-4H3 |
| InChIKey | SZRDRXOFDKSVFI-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.27 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |