C11H25NO — CID 83158137
1-methoxy-N,7-dimethyloctan-2-amine (PubChem CID 83158137) has the molecular formula C11H25NO and a molecular weight of 187.33 g/mol. Its IUPAC name is 1-methoxy-N,7-dimethyloctan-2-amine.
| Compound Name | 1-methoxy-N,7-dimethyloctan-2-amine |
|---|---|
| PubChem CID | 83158137 |
| Molecular Formula | C11H25NO |
| Molecular Weight | 187.33 g/mol |
| Exact Mass | 187.19 |
| IUPAC Name | 1-methoxy-N,7-dimethyloctan-2-amine |
| SMILES | CNC(CCCCC(C)C)COC |
| InChI | InChI=1S/C11H25NO/c1-10(2)7-5-6-8-11(12-3)9-13-4/h10-12H,5-9H2,1-4H3 |
| InChIKey | FXQQQZXFXNFAJM-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.33 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|