C8H21NO2 — CID 171819113
1,3-dimethoxy-N-methylpropan-2-amine;ethane (PubChem CID 171819113) has the molecular formula C8H21NO2 and a molecular weight of 163.26 g/mol. Its IUPAC name is 1,3-dimethoxy-N-methylpropan-2-amine;ethane.
| Compound Name | 1,3-dimethoxy-N-methylpropan-2-amine;ethane |
|---|---|
| PubChem CID | 171819113 |
| Molecular Formula | C8H21NO2 |
| Molecular Weight | 163.26 g/mol |
| Exact Mass | 163.16 |
| IUPAC Name | 1,3-dimethoxy-N-methylpropan-2-amine;ethane |
| SMILES | CC.CNC(COC)COC |
| InChI | InChI=1S/C6H15NO2.C2H6/c1-7-6(4-8-2)5-9-3;1-2/h6-7H,4-5H2,1-3H3;1-2H3 |
| InChIKey | MPFZBIJXTQIXMV-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.26 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |