C8H20N2O2 — CID 163765545
1,4-dimethoxy-2-N,3-N-dimethylbutane-2,3-diamine (PubChem CID 163765545) has the molecular formula C8H20N2O2 and a molecular weight of 176.26 g/mol. Its IUPAC name is 1,4-dimethoxy-2-N,3-N-dimethylbutane-2,3-diamine.
| Compound Name | 1,4-dimethoxy-2-N,3-N-dimethylbutane-2,3-diamine |
|---|---|
| PubChem CID | 163765545 |
| Molecular Formula | C8H20N2O2 |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.15 |
| IUPAC Name | 1,4-dimethoxy-2-N,3-N-dimethylbutane-2,3-diamine |
| SMILES | CNC(COC)C(COC)NC |
| InChI | InChI=1S/C8H20N2O2/c1-9-7(5-11-3)8(10-2)6-12-4/h7-10H,5-6H2,1-4H3 |
| InChIKey | MBYHBKFBOOVPOF-UHFFFAOYSA-N |
| XLogP | -0.54 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |