C12H27NO2 — CID 105185179
1,7-dimethoxy-N,2,5-trimethylheptan-4-amine (PubChem CID 105185179) has the molecular formula C12H27NO2 and a molecular weight of 217.35 g/mol. Its IUPAC name is 1,7-dimethoxy-N,2,5-trimethylheptan-4-amine.
| Compound Name | 1,7-dimethoxy-N,2,5-trimethylheptan-4-amine |
|---|---|
| PubChem CID | 105185179 |
| Molecular Formula | C12H27NO2 |
| Molecular Weight | 217.35 g/mol |
| Exact Mass | 217.20 |
| IUPAC Name | 1,7-dimethoxy-N,2,5-trimethylheptan-4-amine |
| SMILES | CNC(CC(C)COC)C(C)CCOC |
| InChI | InChI=1S/C12H27NO2/c1-10(9-15-5)8-12(13-3)11(2)6-7-14-4/h10-13H,6-9H2,1-5H3 |
| InChIKey | XQAVZTUKTUJFQB-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.35 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |