C14H31NO4 — CID 104560546
1-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]-N,3-dimethylpentan-2-amine (PubChem CID 104560546) has the molecular formula C14H31NO4 and a molecular weight of 277.40 g/mol. Its IUPAC name is 1-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]-N,3-dimethylpentan-2-amine.
| Compound Name | 1-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]-N,3-dimethylpentan-2-amine |
|---|---|
| PubChem CID | 104560546 |
| Molecular Formula | C14H31NO4 |
| Molecular Weight | 277.40 g/mol |
| Exact Mass | 277.23 |
| IUPAC Name | 1-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]-N,3-dimethylpentan-2-amine |
| SMILES | CCC(C)C(COCCOCCOCCOC)NC |
| InChI | InChI=1S/C14H31NO4/c1-5-13(2)14(15-3)12-19-11-10-18-9-8-17-7-6-16-4/h13-15H,5-12H2,1-4H3 |
| InChIKey | FYCVFZRXGLRJFT-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 48.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.40 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|