About N,4-dimethylhexan-3-amine
N,4-dimethylhexan-3-amine (PubChem CID 63559808) has the molecular formula C8H19N
and a molecular weight of 129.25 g/mol. Its IUPAC name is N,4-dimethylhexan-3-amine.
Molecular Properties
| Compound Name | N,4-dimethylhexan-3-amine |
| PubChem CID | 63559808 |
| Molecular Formula | C8H19N |
| Molecular Weight | 129.25 g/mol |
| Exact Mass | 129.15 |
| IUPAC Name | N,4-dimethylhexan-3-amine |
| SMILES | CCC(C)C(CC)NC |
| InChI | InChI=1S/C8H19N/c1-5-7(3)8(6-2)9-4/h7-9H,5-6H2,1-4H3 |
| InChIKey | YEWGDTAMQNBZON-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 129.25 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N,4-dimethylhexan-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,4-dimethylhexan-3-amine?
The IUPAC name of N,4-dimethylhexan-3-amine (CID 63559808) is N,4-dimethylhexan-3-amine.
What is the SMILES notation for N,4-dimethylhexan-3-amine?
The canonical SMILES for N,4-dimethylhexan-3-amine is CCC(C)C(CC)NC.
What is the InChIKey of N,4-dimethylhexan-3-amine?
The InChIKey is YEWGDTAMQNBZON-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H19N/c1-5-7(3)8(6-2)9-4/h7-9H,5-6H2,1-4H3.
What are the key properties of N,4-dimethylhexan-3-amine?
N,4-dimethylhexan-3-amine has a molecular weight of 129.25 g/mol, XLogP of 2.03, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,4-dimethylhexan-3-amine is sourced from PubChem (CID 63559808), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).