C8H19N — CID 63559808
N,4-dimethylhexan-3-amine (PubChem CID 63559808) has the molecular formula C8H19N and a molecular weight of 129.25 g/mol. Its IUPAC name is N,4-dimethylhexan-3-amine.
| Compound Name | N,4-dimethylhexan-3-amine |
|---|---|
| PubChem CID | 63559808 |
| Molecular Formula | C8H19N |
| Molecular Weight | 129.25 g/mol |
| Exact Mass | 129.15 |
| IUPAC Name | N,4-dimethylhexan-3-amine |
| SMILES | CCC(C)C(CC)NC |
| InChI | InChI=1S/C8H19N/c1-5-7(3)8(6-2)9-4/h7-9H,5-6H2,1-4H3 |
| InChIKey | YEWGDTAMQNBZON-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 129.25 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |