C15H25NO — CID 79308478
6-(4-methoxyphenyl)-N,4-dimethylhexan-3-amine (PubChem CID 79308478) has the molecular formula C15H25NO and a molecular weight of 235.37 g/mol. Its IUPAC name is 6-(4-methoxyphenyl)-N,4-dimethylhexan-3-amine.
| Compound Name | 6-(4-methoxyphenyl)-N,4-dimethylhexan-3-amine |
|---|---|
| PubChem CID | 79308478 |
| Molecular Formula | C15H25NO |
| Molecular Weight | 235.37 g/mol |
| Exact Mass | 235.19 |
| IUPAC Name | 6-(4-methoxyphenyl)-N,4-dimethylhexan-3-amine |
| SMILES | CCC(NC)C(C)CCc1ccc(OC)cc1 |
| InChI | InChI=1S/C15H25NO/c1-5-15(16-3)12(2)6-7-13-8-10-14(17-4)11-9-13/h8-12,15-16H,5-7H2,1-4H3 |
| InChIKey | DDWAACTZKMERAC-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.37 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |