C12H20N2O — CID 105200937
1-(4-methoxyphenyl)pentan-3-ylhydrazine (PubChem CID 105200937) has the molecular formula C12H20N2O and a molecular weight of 208.31 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)pentan-3-ylhydrazine.
| Compound Name | 1-(4-methoxyphenyl)pentan-3-ylhydrazine |
|---|---|
| PubChem CID | 105200937 |
| Molecular Formula | C12H20N2O |
| Molecular Weight | 208.31 g/mol |
| Exact Mass | 208.16 |
| IUPAC Name | 1-(4-methoxyphenyl)pentan-3-ylhydrazine |
| SMILES | CCC(CCc1ccc(OC)cc1)NN |
| InChI | InChI=1S/C12H20N2O/c1-3-11(14-13)7-4-10-5-8-12(15-2)9-6-10/h5-6,8-9,11,14H,3-4,7,13H2,1-2H3 |
| InChIKey | HZXCSSJKSCBBSM-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.31 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|