C9H21NS — CID 105170590
N,4-dimethyl-1-methylsulfanylhexan-3-amine (PubChem CID 105170590) has the molecular formula C9H21NS and a molecular weight of 175.34 g/mol. Its IUPAC name is N,4-dimethyl-1-methylsulfanylhexan-3-amine.
| Compound Name | N,4-dimethyl-1-methylsulfanylhexan-3-amine |
|---|---|
| PubChem CID | 105170590 |
| Molecular Formula | C9H21NS |
| Molecular Weight | 175.34 g/mol |
| Exact Mass | 175.14 |
| IUPAC Name | N,4-dimethyl-1-methylsulfanylhexan-3-amine |
| SMILES | CCC(C)C(CCSC)NC |
| InChI | InChI=1S/C9H21NS/c1-5-8(2)9(10-3)6-7-11-4/h8-10H,5-7H2,1-4H3 |
| InChIKey | PQFCCHZRWOMAHX-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.34 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |