C6H16N2S — CID 62065687
2-N-methyl-4-methylsulfanylbutane-1,2-diamine (PubChem CID 62065687) has the molecular formula C6H16N2S and a molecular weight of 148.28 g/mol. Its IUPAC name is 2-N-methyl-4-methylsulfanylbutane-1,2-diamine.
| Compound Name | 2-N-methyl-4-methylsulfanylbutane-1,2-diamine |
|---|---|
| PubChem CID | 62065687 |
| Molecular Formula | C6H16N2S |
| Molecular Weight | 148.28 g/mol |
| Exact Mass | 148.10 |
| IUPAC Name | 2-N-methyl-4-methylsulfanylbutane-1,2-diamine |
| SMILES | CNC(CN)CCSC |
| InChI | InChI=1S/C6H16N2S/c1-8-6(5-7)3-4-9-2/h6,8H,3-5,7H2,1-2H3 |
| InChIKey | ICTFAGJOWLEBNY-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.28 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |