C9H18N2S — CID 103088918
5-methylsulfanyl-2-N-prop-2-ynylpentane-1,2-diamine (PubChem CID 103088918) has the molecular formula C9H18N2S and a molecular weight of 186.32 g/mol. Its IUPAC name is 5-methylsulfanyl-2-N-prop-2-ynylpentane-1,2-diamine.
| Compound Name | 5-methylsulfanyl-2-N-prop-2-ynylpentane-1,2-diamine |
|---|---|
| PubChem CID | 103088918 |
| Molecular Formula | C9H18N2S |
| Molecular Weight | 186.32 g/mol |
| Exact Mass | 186.12 |
| IUPAC Name | 5-methylsulfanyl-2-N-prop-2-ynylpentane-1,2-diamine |
| SMILES | C#CCNC(CN)CCCSC |
| InChI | InChI=1S/C9H18N2S/c1-3-6-11-9(8-10)5-4-7-12-2/h1,9,11H,4-8,10H2,2H3 |
| InChIKey | NCZIYJXROKKZKQ-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.32 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|