C12H26N2S — CID 103089081
2-N-(3-cyclopropylpropyl)-5-methylsulfanylpentane-1,2-diamine (PubChem CID 103089081) has the molecular formula C12H26N2S and a molecular weight of 230.42 g/mol. Its IUPAC name is 2-N-(3-cyclopropylpropyl)-5-methylsulfanylpentane-1,2-diamine.
| Compound Name | 2-N-(3-cyclopropylpropyl)-5-methylsulfanylpentane-1,2-diamine |
|---|---|
| PubChem CID | 103089081 |
| Molecular Formula | C12H26N2S |
| Molecular Weight | 230.42 g/mol |
| Exact Mass | 230.18 |
| IUPAC Name | 2-N-(3-cyclopropylpropyl)-5-methylsulfanylpentane-1,2-diamine |
| SMILES | CSCCCC(CN)NCCCC1CC1 |
| InChI | InChI=1S/C12H26N2S/c1-15-9-3-5-12(10-13)14-8-2-4-11-6-7-11/h11-12,14H,2-10,13H2,1H3 |
| InChIKey | XSTMKPMCOMQBFA-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.42 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|