C10H20N2 — CID 114415959
2-N-but-3-yn-2-ylhexane-1,2-diamine (PubChem CID 114415959) has the molecular formula C10H20N2 and a molecular weight of 168.28 g/mol. Its IUPAC name is 2-N-but-3-yn-2-ylhexane-1,2-diamine.
| Compound Name | 2-N-but-3-yn-2-ylhexane-1,2-diamine |
|---|---|
| PubChem CID | 114415959 |
| Molecular Formula | C10H20N2 |
| Molecular Weight | 168.28 g/mol |
| Exact Mass | 168.16 |
| IUPAC Name | 2-N-but-3-yn-2-ylhexane-1,2-diamine |
| SMILES | C#CC(C)NC(CN)CCCC |
| InChI | InChI=1S/C10H20N2/c1-4-6-7-10(8-11)12-9(3)5-2/h2,9-10,12H,4,6-8,11H2,1,3H3 |
| InChIKey | LPWOKHWZUMQVMZ-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.28 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|