C9H18N2 — CID 167266831
2-N-prop-1-ynylhexane-1,2-diamine (PubChem CID 167266831) has the molecular formula C9H18N2 and a molecular weight of 154.26 g/mol. Its IUPAC name is 2-N-prop-1-ynylhexane-1,2-diamine.
| Compound Name | 2-N-prop-1-ynylhexane-1,2-diamine |
|---|---|
| PubChem CID | 167266831 |
| Molecular Formula | C9H18N2 |
| Molecular Weight | 154.26 g/mol |
| Exact Mass | 154.15 |
| IUPAC Name | 2-N-prop-1-ynylhexane-1,2-diamine |
| SMILES | CC#CNC(CN)CCCC |
| InChI | InChI=1S/C9H18N2/c1-3-5-6-9(8-10)11-7-4-2/h9,11H,3,5-6,8,10H2,1-2H3 |
| InChIKey | PJRCGMZSNQTBCL-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.26 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|