About 2-butylpropane-1,3-diamine;ethane
2-butylpropane-1,3-diamine;ethane (PubChem CID 142824010) has the molecular formula C9H24N2
and a molecular weight of 160.31 g/mol. Its IUPAC name is 2-butylpropane-1,3-diamine;ethane.
Molecular Properties
| Compound Name | 2-butylpropane-1,3-diamine;ethane |
| PubChem CID | 142824010 |
| Molecular Formula | C9H24N2 |
| Molecular Weight | 160.31 g/mol |
| Exact Mass | 160.19 |
| IUPAC Name | 2-butylpropane-1,3-diamine;ethane |
| SMILES | CC.CCCCC(CN)CN |
| InChI | InChI=1S/C7H18N2.C2H6/c1-2-3-4-7(5-8)6-9;1-2/h7H,2-6,8-9H2,1H3;1-2H3 |
| InChIKey | MHGGQMFPVKLVJC-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.31 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-butylpropane-1,3-diamine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butylpropane-1,3-diamine;ethane?
The IUPAC name of 2-butylpropane-1,3-diamine;ethane (CID 142824010) is 2-butylpropane-1,3-diamine;ethane.
What is the SMILES notation for 2-butylpropane-1,3-diamine;ethane?
The canonical SMILES for 2-butylpropane-1,3-diamine;ethane is CC.CCCCC(CN)CN.
What is the InChIKey of 2-butylpropane-1,3-diamine;ethane?
The InChIKey is MHGGQMFPVKLVJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H18N2.C2H6/c1-2-3-4-7(5-8)6-9;1-2/h7H,2-6,8-9H2,1H3;1-2H3.
What are the key properties of 2-butylpropane-1,3-diamine;ethane?
2-butylpropane-1,3-diamine;ethane has a molecular weight of 160.31 g/mol, XLogP of 1.74, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butylpropane-1,3-diamine;ethane is sourced from PubChem (CID 142824010), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).