About 2-butylhex-4-en-1-amine
2-butylhex-4-en-1-amine (PubChem CID 91034003) has the molecular formula C10H21N
and a molecular weight of 155.28 g/mol. Its IUPAC name is 2-butylhex-4-en-1-amine.
Molecular Properties
| Compound Name | 2-butylhex-4-en-1-amine |
| PubChem CID | 91034003 |
| Molecular Formula | C10H21N |
| Molecular Weight | 155.28 g/mol |
| Exact Mass | 155.17 |
| IUPAC Name | 2-butylhex-4-en-1-amine |
| SMILES | CC=CCC(CN)CCCC |
| InChI | InChI=1S/C10H21N/c1-3-5-7-10(9-11)8-6-4-2/h3,5,10H,4,6-9,11H2,1-2H3 |
| InChIKey | FFRRRDZKKWOFIP-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.28 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-butylhex-4-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butylhex-4-en-1-amine?
The IUPAC name of 2-butylhex-4-en-1-amine (CID 91034003) is 2-butylhex-4-en-1-amine.
What is the SMILES notation for 2-butylhex-4-en-1-amine?
The canonical SMILES for 2-butylhex-4-en-1-amine is CC=CCC(CN)CCCC.
What is the InChIKey of 2-butylhex-4-en-1-amine?
The InChIKey is FFRRRDZKKWOFIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H21N/c1-3-5-7-10(9-11)8-6-4-2/h3,5,10H,4,6-9,11H2,1-2H3.
What are the key properties of 2-butylhex-4-en-1-amine?
2-butylhex-4-en-1-amine has a molecular weight of 155.28 g/mol, XLogP of 2.72, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butylhex-4-en-1-amine is sourced from PubChem (CID 91034003), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).