About 2-ethylhexan-1-amine;dihydrochloride
2-ethylhexan-1-amine;dihydrochloride (PubChem CID 142641821) has the molecular formula C8H21Cl2N
and a molecular weight of 202.17 g/mol. Its IUPAC name is 2-ethylhexan-1-amine;dihydrochloride.
Molecular Properties
| Compound Name | 2-ethylhexan-1-amine;dihydrochloride |
| PubChem CID | 142641821 |
| Molecular Formula | C8H21Cl2N |
| Molecular Weight | 202.17 g/mol |
| Exact Mass | 201.11 |
| IUPAC Name | 2-ethylhexan-1-amine;dihydrochloride |
| SMILES | CCCCC(CC)CN.Cl.Cl |
| InChI | InChI=1S/C8H19N.2ClH/c1-3-5-6-8(4-2)7-9;;/h8H,3-7,9H2,1-2H3;2*1H |
| InChIKey | OKSWALPATFVFPJ-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.17 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-ethylhexan-1-amine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethylhexan-1-amine;dihydrochloride?
The IUPAC name of 2-ethylhexan-1-amine;dihydrochloride (CID 142641821) is 2-ethylhexan-1-amine;dihydrochloride.
What is the SMILES notation for 2-ethylhexan-1-amine;dihydrochloride?
The canonical SMILES for 2-ethylhexan-1-amine;dihydrochloride is CCCCC(CC)CN.Cl.Cl.
What is the InChIKey of 2-ethylhexan-1-amine;dihydrochloride?
The InChIKey is OKSWALPATFVFPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H19N.2ClH/c1-3-5-6-8(4-2)7-9;;/h8H,3-7,9H2,1-2H3;2*1H.
What are the key properties of 2-ethylhexan-1-amine;dihydrochloride?
2-ethylhexan-1-amine;dihydrochloride has a molecular weight of 202.17 g/mol, XLogP of 3.01, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethylhexan-1-amine;dihydrochloride is sourced from PubChem (CID 142641821), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).