C24H52ClN — CID 23468552
2-ethyl-N,N-bis(2-ethylhexyl)hexan-1-amine;hydrochloride (PubChem CID 23468552) has the molecular formula C24H52ClN and a molecular weight of 390.14 g/mol. Its IUPAC name is 2-ethyl-N,N-bis(2-ethylhexyl)hexan-1-amine;hydrochloride.
| Compound Name | 2-ethyl-N,N-bis(2-ethylhexyl)hexan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 23468552 |
| Molecular Formula | C24H52ClN |
| Molecular Weight | 390.14 g/mol |
| Exact Mass | 389.38 |
| IUPAC Name | 2-ethyl-N,N-bis(2-ethylhexyl)hexan-1-amine;hydrochloride |
| SMILES | CCCCC(CC)CN(CC(CC)CCCC)CC(CC)CCCC.Cl |
| InChI | InChI=1S/C24H51N.ClH/c1-7-13-16-22(10-4)19-25(20-23(11-5)17-14-8-2)21-24(12-6)18-15-9-3;/h22-24H,7-21H2,1-6H3;1H |
| InChIKey | GYLSOTHWIRBUBJ-UHFFFAOYSA-N |
| XLogP | 8.36 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.14 |
| LogP ≤ 5 | 8.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |