C14H25K2NO4 — CID 142284997
dipotassium;3-[2-carboxylatoethyl(2-ethylhexyl)amino]propanoate (PubChem CID 142284997) has the molecular formula C14H25K2NO4 and a molecular weight of 349.55 g/mol. Its IUPAC name is dipotassium;3-[2-carboxylatoethyl(2-ethylhexyl)amino]propanoate.
| Compound Name | dipotassium;3-[2-carboxylatoethyl(2-ethylhexyl)amino]propanoate |
|---|---|
| PubChem CID | 142284997 |
| Molecular Formula | C14H25K2NO4 |
| Molecular Weight | 349.55 g/mol |
| Exact Mass | 349.11 |
| IUPAC Name | dipotassium;3-[2-carboxylatoethyl(2-ethylhexyl)amino]propanoate |
| SMILES | CCCCC(CC)CN(CCC(=O)[O-])CCC(=O)[O-].[K+].[K+] |
| InChI | InChI=1S/C14H27NO4.2K/c1-3-5-6-12(4-2)11-15(9-7-13(16)17)10-8-14(18)19;;/h12H,3-11H2,1-2H3,(H,16,17)(H,18,19);;/q;2*+1/p-2 |
| InChIKey | ZZSYCEOIIIKRBI-UHFFFAOYSA-L |
| XLogP | -6.21 |
| TPSA | 83.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.55 |
| LogP ≤ 5 | -6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |