C38H76N2O2 — CID 20752277
N,N,N',N'-tetrakis(2-ethylhexyl)hexanediamide (PubChem CID 20752277) has the molecular formula C38H76N2O2 and a molecular weight of 593.04 g/mol. Its IUPAC name is N,N,N',N'-tetrakis(2-ethylhexyl)hexanediamide.
| Compound Name | N,N,N',N'-tetrakis(2-ethylhexyl)hexanediamide |
|---|---|
| PubChem CID | 20752277 |
| Molecular Formula | C38H76N2O2 |
| Molecular Weight | 593.04 g/mol |
| Exact Mass | 592.59 |
| IUPAC Name | N,N,N',N'-tetrakis(2-ethylhexyl)hexanediamide |
| SMILES | CCCCC(CC)CN(CC(CC)CCCC)C(=O)CCCCC(=O)N(CC(CC)CCCC)CC(CC)CCCC |
| InChI | InChI=1S/C38H76N2O2/c1-9-17-23-33(13-5)29-39(30-34(14-6)24-18-10-2)37(41)27-21-22-28-38(42)40(31-35(15-7)25-19-11-3)32-36(16-8)26-20-12-4/h33-36H,9-32H2,1-8H3 |
| InChIKey | YCVLFFGFEBSDMR-UHFFFAOYSA-N |
| XLogP | 11.07 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.04 |
| LogP ≤ 5 | 11.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|