C39H78N2O2 — CID 20752249
2,2-diethyl-N,N,N',N'-tetrakis(2-ethylhexyl)propanediamide (PubChem CID 20752249) has the molecular formula C39H78N2O2 and a molecular weight of 607.07 g/mol. Its IUPAC name is 2,2-diethyl-N,N,N',N'-tetrakis(2-ethylhexyl)propanediamide.
| Compound Name | 2,2-diethyl-N,N,N',N'-tetrakis(2-ethylhexyl)propanediamide |
|---|---|
| PubChem CID | 20752249 |
| Molecular Formula | C39H78N2O2 |
| Molecular Weight | 607.07 g/mol |
| Exact Mass | 606.61 |
| IUPAC Name | 2,2-diethyl-N,N,N',N'-tetrakis(2-ethylhexyl)propanediamide |
| SMILES | CCCCC(CC)CN(CC(CC)CCCC)C(=O)C(CC)(CC)C(=O)N(CC(CC)CCCC)CC(CC)CCCC |
| InChI | InChI=1S/C39H78N2O2/c1-11-21-25-33(15-5)29-40(30-34(16-6)26-22-12-2)37(42)39(19-9,20-10)38(43)41(31-35(17-7)27-23-13-3)32-36(18-8)28-24-14-4/h33-36H,11-32H2,1-10H3 |
| InChIKey | AKBGXXUYAFXXGE-UHFFFAOYSA-N |
| XLogP | 11.32 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.07 |
| LogP ≤ 5 | 11.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|