C18H36ClNO — CID 129361637
2-chloro-N,N-bis[(2R)-2-ethylhexyl]acetamide (PubChem CID 129361637) has the molecular formula C18H36ClNO and a molecular weight of 317.95 g/mol. Its IUPAC name is 2-chloro-N,N-bis[(2R)-2-ethylhexyl]acetamide.
| Compound Name | 2-chloro-N,N-bis[(2R)-2-ethylhexyl]acetamide |
|---|---|
| PubChem CID | 129361637 |
| Molecular Formula | C18H36ClNO |
| Molecular Weight | 317.95 g/mol |
| Exact Mass | 317.25 |
| IUPAC Name | 2-chloro-N,N-bis[(2R)-2-ethylhexyl]acetamide |
| SMILES | CCCCC(CC)CN(C[C@H](CC)CCCC)C(=O)CCl |
| InChI | InChI=1S/C18H36ClNO/c1-5-9-11-16(7-3)14-20(18(21)13-19)15-17(8-4)12-10-6-2/h16-17H,5-15H2,1-4H3/t16-,17?/m1/s1 |
| InChIKey | GTLDINRZFOGPQE-TZHYSIJRSA-N |
| XLogP | 5.49 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.95 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|