C35H68N2O2 — CID 21053692
(E)-N,N,N'-tris(2-ethylhexyl)-N'-(2-ethyl-3-methylbutyl)but-2-enediamide (PubChem CID 21053692) has the molecular formula C35H68N2O2 and a molecular weight of 548.94 g/mol. Its IUPAC name is (E)-N,N,N'-tris(2-ethylhexyl)-N'-(2-ethyl-3-methylbutyl)but-2-enediamide.
| Compound Name | (E)-N,N,N'-tris(2-ethylhexyl)-N'-(2-ethyl-3-methylbutyl)but-2-enediamide |
|---|---|
| PubChem CID | 21053692 |
| Molecular Formula | C35H68N2O2 |
| Molecular Weight | 548.94 g/mol |
| Exact Mass | 548.53 |
| IUPAC Name | (E)-N,N,N'-tris(2-ethylhexyl)-N'-(2-ethyl-3-methylbutyl)but-2-enediamide |
| SMILES | CCCCC(CC)CN(CC(CC)CCCC)C(=O)/C=C/C(=O)N(CC(CC)CCCC)CC(CC)C(C)C |
| InChI | InChI=1S/C35H68N2O2/c1-10-17-20-30(13-4)25-36(26-31(14-5)21-18-11-2)34(38)23-24-35(39)37(28-33(16-7)29(8)9)27-32(15-6)22-19-12-3/h23-24,29-33H,10-22,25-28H2,1-9H3/b24-23+ |
| InChIKey | CFXDRPOPFAWGKZ-WCWDXBQESA-N |
| XLogP | 9.53 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.94 |
| LogP ≤ 5 | 9.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|