C38H75N3O4 — CID 138501386
2-[bis[2-[bis(2-ethylhexyl)amino]-2-oxoethyl]amino]acetic acid (PubChem CID 138501386) has the molecular formula C38H75N3O4 and a molecular weight of 638.04 g/mol. Its IUPAC name is 2-[bis[2-[bis(2-ethylhexyl)amino]-2-oxoethyl]amino]acetic acid.
| Compound Name | 2-[bis[2-[bis(2-ethylhexyl)amino]-2-oxoethyl]amino]acetic acid |
|---|---|
| PubChem CID | 138501386 |
| Molecular Formula | C38H75N3O4 |
| Molecular Weight | 638.04 g/mol |
| Exact Mass | 637.58 |
| IUPAC Name | 2-[bis[2-[bis(2-ethylhexyl)amino]-2-oxoethyl]amino]acetic acid |
| SMILES | CCCCC(CC)CN(CC(CC)CCCC)C(=O)CN(CC(=O)O)CC(=O)N(CC(CC)CCCC)CC(CC)CCCC |
| InChI | InChI=1S/C38H75N3O4/c1-9-17-21-32(13-5)25-40(26-33(14-6)22-18-10-2)36(42)29-39(31-38(44)45)30-37(43)41(27-34(15-7)23-19-11-3)28-35(16-8)24-20-12-4/h32-35H,9-31H2,1-8H3,(H,44,45) |
| InChIKey | NBOKVDSITPLUTK-UHFFFAOYSA-N |
| XLogP | 8.90 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.04 |
| LogP ≤ 5 | 8.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |