C18H35N3O4 — CID 138501380
2-[bis[2-(dipropylamino)-2-oxoethyl]amino]acetic acid (PubChem CID 138501380) has the molecular formula C18H35N3O4 and a molecular weight of 357.50 g/mol. Its IUPAC name is 2-[bis[2-(dipropylamino)-2-oxoethyl]amino]acetic acid.
| Compound Name | 2-[bis[2-(dipropylamino)-2-oxoethyl]amino]acetic acid |
|---|---|
| PubChem CID | 138501380 |
| Molecular Formula | C18H35N3O4 |
| Molecular Weight | 357.50 g/mol |
| Exact Mass | 357.26 |
| IUPAC Name | 2-[bis[2-(dipropylamino)-2-oxoethyl]amino]acetic acid |
| SMILES | CCCN(CCC)C(=O)CN(CC(=O)O)CC(=O)N(CCC)CCC |
| InChI | InChI=1S/C18H35N3O4/c1-5-9-20(10-6-2)16(22)13-19(15-18(24)25)14-17(23)21(11-7-3)12-8-4/h5-15H2,1-4H3,(H,24,25) |
| InChIKey | BUCDNDDTKWRFIX-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.50 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |