C15H30N2O3 — CID 82327114
3-[[2-(dipropylamino)-2-oxoethyl]-propylamino]-2-methylpropanoic acid (PubChem CID 82327114) has the molecular formula C15H30N2O3 and a molecular weight of 286.42 g/mol. Its IUPAC name is 3-[[2-(dipropylamino)-2-oxoethyl]-propylamino]-2-methylpropanoic acid.
| Compound Name | 3-[[2-(dipropylamino)-2-oxoethyl]-propylamino]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 82327114 |
| Molecular Formula | C15H30N2O3 |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.23 |
| IUPAC Name | 3-[[2-(dipropylamino)-2-oxoethyl]-propylamino]-2-methylpropanoic acid |
| SMILES | CCCN(CC(=O)N(CCC)CCC)CC(C)C(=O)O |
| InChI | InChI=1S/C15H30N2O3/c1-5-8-16(11-13(4)15(19)20)12-14(18)17(9-6-2)10-7-3/h13H,5-12H2,1-4H3,(H,19,20) |
| InChIKey | JFLZAMQXPYIOSK-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |