C32H68N2 — CID 123650144
1,1,2,2-tetrakis(2-ethylhexyl)hydrazine (PubChem CID 123650144) has the molecular formula C32H68N2 and a molecular weight of 480.91 g/mol. Its IUPAC name is 1,1,2,2-tetrakis(2-ethylhexyl)hydrazine.
| Compound Name | 1,1,2,2-tetrakis(2-ethylhexyl)hydrazine |
|---|---|
| PubChem CID | 123650144 |
| Molecular Formula | C32H68N2 |
| Molecular Weight | 480.91 g/mol |
| Exact Mass | 480.54 |
| IUPAC Name | 1,1,2,2-tetrakis(2-ethylhexyl)hydrazine |
| SMILES | CCCCC(CC)CN(CC(CC)CCCC)N(CC(CC)CCCC)CC(CC)CCCC |
| InChI | InChI=1S/C32H68N2/c1-9-17-21-29(13-5)25-33(26-30(14-6)22-18-10-2)34(27-31(15-7)23-19-11-3)28-32(16-8)24-20-12-4/h29-32H,9-28H2,1-8H3 |
| InChIKey | QQXKVJFFMVNRJQ-UHFFFAOYSA-N |
| XLogP | 10.37 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.91 |
| LogP ≤ 5 | 10.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|